Products 312728-68-0
CAS 312728-68-0 is the registry number for rac-(1R,2R,6S,7S)-4-Azatricyclo(5.2.2.0,2,6)undec-8-ene hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R,2R,6S,7S)-4-azatricyclo[5.2.2.02,6]undec-8-ene;hydrochloride (CAS 312728-68-0) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1R,2R,6S,7S)-4-azatricyclo[5.2.2.02,6]undec-8-ene;hydrochloride. InChIKey: DSXBNFSUBKMSIB-QPBKEMMPSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1R,2R,6S,7S)-4-azatricyclo[5.2.2.02,6]undec-8-ene;hydrochloride |
| InChIKey | DSXBNFSUBKMSIB-QPBKEMMPSA-N |
| SMILES | C1C[C@H]2C=C[C@@H]1[C@@H]3[C@H]2CNC3.Cl |
Computed by PubChem (NCBI)