CAS 31283-69-9 is the registry number for 2-Pyridinecarboxylic acid, 5-methyl-, 1-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-methyl-1-oxidopyridin-1-ium-2-carboxylic acid (CAS 31283-69-9) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 5-methyl-1-oxidopyridin-1-ium-2-carboxylic acid. InChIKey: SJTZUVQHMFBVRX-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 5-methyl-1-oxidopyridin-1-ium-2-carboxylic acid |
| InChIKey | SJTZUVQHMFBVRX-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C=C1)C(=O)O)[O-] |
Computed by PubChem (NCBI)