Products 3130-75-4
CAS 3130-75-4 appears in our catalog under these names: 4–Phthalimidobutyric Acid, 4-Phthalimidobutyric Acid, >95% (HPLC), 4-Phthalimidobutyric Acid, >98.0%(HPLC)(T), O-Phthalimide-C3-acid 98%, 4-(1,3-Dioxoisoindolin-2-yl)butanoic acid, 98%, 98%. Offered by: GLPBio, TRC, TCI, Ambeed, Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 25g, 250 mg, 500 mg.
4-(1,3-dioxoisoindol-2-yl)butanoic acid (CAS 3130-75-4) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)butanoic acid. InChIKey: HMKSXJBFBVGLJJ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 4-(1,3-dioxoisoindol-2-yl)butanoic acid |
| InChIKey | HMKSXJBFBVGLJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Phthalimidobutyric acid, 1,3-Dihydro-1,3-dioxo-2H-isoindole-2-butanoic acid, N-Phthalyl-gamma-aminobutyric acid, 2H-Isoindole-2-butanoic acid, 1,3-dihydro-1,3-dioxo-, 4-(1,3-dioxoisoindolin-2-yl)butanoic acid, 4-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoic acid, 4-(1,3-dioxoisoindol-2-yl)butanoic acid, Butyric acid, 4-phthalimido-, 4-Phthalimidobuttersaure, 4-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-butyric acid