CAS 313259-41-5 is the registry number for Sulpiride Impurity 25. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-chloro-5-[(4-methylphenyl)sulfamoyl]benzoic acid (CAS 313259-41-5) is a chemical compound with the molecular formula C14H12ClNO4S and a molecular weight of 325.8 g/mol. IUPAC name: 2-chloro-5-[(4-methylphenyl)sulfamoyl]benzoic acid. InChIKey: OMCGHCMQAFZAEE-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO4S |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | 2-chloro-5-[(4-methylphenyl)sulfamoyl]benzoic acid |
| InChIKey | OMCGHCMQAFZAEE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)