Products 313369-17-4
CAS 313369-17-4 is the registry number for Lumateperone Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate (CAS 313369-17-4) is a chemical compound with the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. IUPAC name: ethyl (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate. InChIKey: SWTLTYLHHUNZMX-JSGCOSHPSA-N.
| Molecular formula | C16H21N3O2 |
|---|---|
| Molecular weight | 287.36 g/mol |
| IUPAC name | ethyl (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate |
| InChIKey | SWTLTYLHHUNZMX-JSGCOSHPSA-N |
| SMILES | CCOC(=O)N1CC[C@H]2[C@@H](C1)C3=C4N2CCNC4=CC=C3 |
Computed by PubChem (NCBI)