CAS 313376-81-7 appears in our catalog under these names: 1-((3-Bromophenyl)methyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione, 95%, 1-((3-Bromophenyl)methyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-[(3-bromophenyl)methyl]pyrimidine-2,4-dione (CAS 313376-81-7) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: 1-[(3-bromophenyl)methyl]pyrimidine-2,4-dione. InChIKey: BTODMHTXMMIULV-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | 1-[(3-bromophenyl)methyl]pyrimidine-2,4-dione |
| InChIKey | BTODMHTXMMIULV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CN2C=CC(=O)NC2=O |
Computed by PubChem (NCBI)