CAS 313494-64-3 is the registry number for 2-Phenyl-1H-benzoimidazol-4-ylamine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-phenyl-1H-benzimidazol-4-amine (CAS 313494-64-3) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 2-phenyl-1H-benzimidazol-4-amine. InChIKey: PVNHYDDCQMHWAL-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 2-phenyl-1H-benzimidazol-4-amine |
| InChIKey | PVNHYDDCQMHWAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC=C3N2)N |
Computed by PubChem (NCBI)