CAS 313527-44-5 is the registry number for MeV-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-benzyl-1,3-benzoxazol-5-amine (CAS 313527-44-5) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 2-benzyl-1,3-benzoxazol-5-amine. InChIKey: KYWJNXDUENQSPB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-benzyl-1,3-benzoxazol-5-amine |
| InChIKey | KYWJNXDUENQSPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)