Products 313653-15-5
CAS 313653-15-5 is the registry number for α2δ ligand 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S,5R)-3-(aminomethyl)-5-methyloctanoic acid;hydrochloride (CAS 313653-15-5) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: (3S,5R)-3-(aminomethyl)-5-methyloctanoic acid;hydrochloride. InChIKey: IRDFQFUZIBIBFQ-RJUBDTSPSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | (3S,5R)-3-(aminomethyl)-5-methyloctanoic acid;hydrochloride |
| InChIKey | IRDFQFUZIBIBFQ-RJUBDTSPSA-N |
| SMILES | CCC[C@@H](C)C[C@@H](CC(=O)O)CN.Cl |
Computed by PubChem (NCBI)