CAS 313674-12-3 appears in our catalog under these names: 2-Chloro-4-(1H-pyrazol-1-yl)benzenecarboxylic acid, 98%, 2–Chloro–4–(1H–pyrazol–1–yl)benzoic acid, 2-CHLORO-4-(1H-PYRAZOL-1-YL)BENZENECARBOXYLIC ACID, 95%, 95%, 2-Chloro-4-(1H-pyrazol-1-yl)benzoic acid, 98%, 2-Chloro-4-(1H-pyrazol-1-yl)benzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 250mg, 1g, 5g, 100mg, 2.5g.
2-chloro-4-pyrazol-1-ylbenzoic acid (CAS 313674-12-3) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 2-chloro-4-pyrazol-1-ylbenzoic acid. InChIKey: JBLRHBKKTPDCTI-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 2-chloro-4-pyrazol-1-ylbenzoic acid |
| InChIKey | JBLRHBKKTPDCTI-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC(=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)