CAS 313965-54-7 is the registry number for 5,7-Dimethyl-2-oxo-1,2-dihydroquinolin-8-yl acetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(5,7-dimethyl-2-oxo-1H-quinolin-8-yl) acetate (CAS 313965-54-7) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: (5,7-dimethyl-2-oxo-1H-quinolin-8-yl) acetate. InChIKey: COPQHXSLEALHFB-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (5,7-dimethyl-2-oxo-1H-quinolin-8-yl) acetate |
| InChIKey | COPQHXSLEALHFB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1C=CC(=O)N2)OC(=O)C)C |
Computed by PubChem (NCBI)