CAS 314751-32-1 appears in our catalog under these names: N-(4-Hydroxyphenyl)-3-methylbenzamide, 95%, N-(4-Hydroxyphenyl)-3-methylbenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g.
N-(4-hydroxyphenyl)-3-methylbenzamide (CAS 314751-32-1) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: N-(4-hydroxyphenyl)-3-methylbenzamide. InChIKey: SAKAFVKKYGXYEN-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)-3-methylbenzamide |
| InChIKey | SAKAFVKKYGXYEN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)