Products 31539-68-1
CAS 31539-68-1 is the registry number for Phenyl(1,3,5-trimethyl-1h-pyrazol-4-yl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Phenyl-(1,3,5-trimethylpyrazol-4-yl)methanone (CAS 31539-68-1) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: phenyl-(1,3,5-trimethylpyrazol-4-yl)methanone. InChIKey: HNWVAVCLBLTIKP-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | phenyl-(1,3,5-trimethylpyrazol-4-yl)methanone |
| InChIKey | HNWVAVCLBLTIKP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)