CAS 3156-44-3 is the registry number for 1-(3-Hydroxyphenyl)-2-nitroethene. Offered by: Biosynth. Available pack sizes: 2g, 5g, 10g.
3-(2-nitroethenyl)phenol (CAS 3156-44-3) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 3-(2-nitroethenyl)phenol. InChIKey: DHTXBJQMDPODIB-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 3-(2-nitroethenyl)phenol |
| InChIKey | DHTXBJQMDPODIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C=C[N+](=O)[O-] |
Computed by PubChem (NCBI)