Products 3157-27-5
CAS 3157-27-5 appears in our catalog under these names: Etomidate EP Impurity A, 1-(1-Phenylethyl)-1H-imidazole-5-carboxylic acid, ≥95%, ≥95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10mg, 50mg, 100mg.
3-(1-phenylethyl)imidazole-4-carboxylic acid (CAS 3157-27-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3-(1-phenylethyl)imidazole-4-carboxylic acid. InChIKey: RGYCCBLTSWHXIS-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3-(1-phenylethyl)imidazole-4-carboxylic acid |
| InChIKey | RGYCCBLTSWHXIS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)N2C=NC=C2C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-(1-phenylethyl)-1H-imidazole-5-carboxylic acid, Desethyl-etomidate, Etomidate acid, (RS)-, Desethyl-etomidate, (RS)-, Etomidate impurity A [EP], Etomidate specified impurity A [EP], 1H-Imidazole-5-carboxylic acid, 1-(1-phenylethyl)-, ETOMIDATE IMPURITY A [EP IMPURITY], Etomidate impurity A, Etomidate impurity, etomidate acid-(USP)