Products 56649-49-1
CAS 56649-49-1 appears in our catalog under these names: Etomidate Impurity 28 ((S)-Etomidate Acid), S-Isomer Etomidate Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3-[(1S)-1-phenylethyl]imidazole-4-carboxylic acid (CAS 56649-49-1) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 3-[(1S)-1-phenylethyl]imidazole-4-carboxylic acid. InChIKey: RGYCCBLTSWHXIS-VIFPVBQESA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 3-[(1S)-1-phenylethyl]imidazole-4-carboxylic acid |
| InChIKey | RGYCCBLTSWHXIS-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N2C=NC=C2C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-Desethyl-etomidate, Desethyl-etomidate, (S)-, 3-[(1S)-1-phenylethyl]imidazole-4-carboxylic acid, S-Isomer Etomidate Acid, 1H-Imidazole-5-carboxylic acid, 1-((1S)-1-phenylethyl)-, 1H-Imidazole-5-carboxylic acid, 1-(1-phenylethyl)-, (S)-, (S)-Etomidate EP Impurity A, (S)-1-(1-phenylethyl)-1H-imidazole-5-carboxylic acid, 1-[(1S)-1-Phenylethyl]-1H-imidazole-5-carboxylic acid