CAS 315703-60-7 is the registry number for 4-((4-(2-Methylimidazo[1,2-a]pyridin-3-yl)thiazol-2-yl)amino)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol (CAS 315703-60-7) is a chemical compound with the molecular formula C17H14N4OS and a molecular weight of 322.4 g/mol. IUPAC name: 4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol. InChIKey: WNJPSYHJVTYTBP-UHFFFAOYSA-N.
| Molecular formula | C17H14N4OS |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol |
| InChIKey | WNJPSYHJVTYTBP-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=CC=CC2=N1)C3=CSC(=N3)NC4=CC=C(C=C4)O |
Computed by PubChem (NCBI)