CAS 335215-64-0 is the registry number for 2-((5,6-Diphenyl-1,2,4-triazin-3-yl)thio)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]acetamide (CAS 335215-64-0) is a chemical compound with the molecular formula C17H14N4OS and a molecular weight of 322.4 g/mol. IUPAC name: 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]acetamide. InChIKey: OVUWIVDIMTZZPB-UHFFFAOYSA-N.
| Molecular formula | C17H14N4OS |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]acetamide |
| InChIKey | OVUWIVDIMTZZPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=NC(=N2)SCC(=O)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)