CAS 85772-36-7 is the registry number for 4-(2,4-Dimethylphenyl)-1-mercapto[1,2,4]triazolo[4,3-a]quinazolin-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(2,4-dimethylphenyl)-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one (CAS 85772-36-7) is a chemical compound with the molecular formula C17H14N4OS and a molecular weight of 322.4 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one. InChIKey: YAJUUBCNFFANJR-UHFFFAOYSA-N.
| Molecular formula | C17H14N4OS |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| InChIKey | YAJUUBCNFFANJR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=O)C3=CC=CC=C3N4C2=NNC4=S)C |
Computed by PubChem (NCBI)