Products 3162-45-6
CAS 3162-45-6 appears in our catalog under these names: 6-Methoxywogonin, 98.0%, 6-Methoxywogonin, 98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 1 mg, 5mg.
5,7-dihydroxy-6,8-dimethoxy-2-phenylchromen-4-one (CAS 3162-45-6) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 5,7-dihydroxy-6,8-dimethoxy-2-phenylchromen-4-one. InChIKey: RBVYFSLWUBLPMG-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 5,7-dihydroxy-6,8-dimethoxy-2-phenylchromen-4-one |
| InChIKey | RBVYFSLWUBLPMG-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1O)C(=O)C=C(O2)C3=CC=CC=C3)OC)O |
Computed by PubChem (NCBI)