CAS 316363-65-2 appears in our catalog under these names: Lurasidone Impurity 2, N-((R)-1-Phenylethyl)-methanesulfonamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
N-[(1R)-1-phenylethyl]methanesulfonamide (CAS 316363-65-2) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: N-[(1R)-1-phenylethyl]methanesulfonamide. InChIKey: SHEXGLJFVVRUCZ-MRVPVSSYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | N-[(1R)-1-phenylethyl]methanesulfonamide |
| InChIKey | SHEXGLJFVVRUCZ-MRVPVSSYSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NS(=O)(=O)C |
Computed by PubChem (NCBI)