CAS 317374-08-6 appears in our catalog under these names: Tolvaptan Impurity 54, 2-Methyl-4-(2-methylbenzamido)benzoic acid, 2-Methyl-4-(2-methylbenzamido)benzoic acid 97%, 2-Methyl-4-(2-methylbenzamido)benzoic acid, 97%, 97%, 2-Methyl-4-(2-methylbenzamido)benzoic acid, 95%. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 25g, 5g, 10g, 100g, 1g.
2-methyl-4-[(2-methylbenzoyl)amino]benzoic acid (CAS 317374-08-6) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 2-methyl-4-[(2-methylbenzoyl)amino]benzoic acid. InChIKey: KJGSVQLCVULXJU-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 2-methyl-4-[(2-methylbenzoyl)amino]benzoic acid |
| InChIKey | KJGSVQLCVULXJU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)