CAS 318270-08-5 appears in our catalog under these names: 2-Amino-2-(4-ethylphenyl)acetic acid, 98%, 2-Amino-2-(4-ethylphenyl)acetic acid, 97%, 2-Amino-2-(4-ethylphenyl)acetic Acid. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 0,5g.
2-amino-2-(4-ethylphenyl)acetic acid (CAS 318270-08-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2-amino-2-(4-ethylphenyl)acetic acid. InChIKey: PWKCANDKDKPYIT-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-amino-2-(4-ethylphenyl)acetic acid |
| InChIKey | PWKCANDKDKPYIT-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(C(=O)O)N |
Computed by PubChem (NCBI)