Products 318292-54-5
CAS 318292-54-5 is the registry number for Ethyl 6-bromo-3-formyl-1H-indole-2-carboxylate, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 6-bromo-3-formyl-1H-indole-2-carboxylate (CAS 318292-54-5) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: ethyl 6-bromo-3-formyl-1H-indole-2-carboxylate. InChIKey: NSOKODKCMXZQQB-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO3 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | ethyl 6-bromo-3-formyl-1H-indole-2-carboxylate |
| InChIKey | NSOKODKCMXZQQB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C=C(C=C2)Br)C=O |
Computed by PubChem (NCBI)