CAS 3188-46-3 appears in our catalog under these names: 17beta-Estradiol-16,16-d2, >95% (HPLC), 17beta-Estradiol-16,16-d2, 98 atom % D, min 98% Chemical Purity, Estradiol–d2–1, Estradiol-d2-1, 97.00%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 1 mg, 5 mg.
(8R,9S,13S,14S,17S)-16,16-dideuterio-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (CAS 3188-46-3) is a chemical compound with the molecular formula C18H24O2 and a molecular weight of 274.4 g/mol. IUPAC name: (8R,9S,13S,14S,17S)-16,16-dideuterio-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol. InChIKey: VOXZDWNPVJITMN-IRXRDFFPSA-N.
| Molecular formula | C18H24O2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | (8R,9S,13S,14S,17S)-16,16-dideuterio-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | VOXZDWNPVJITMN-IRXRDFFPSA-N |
| SMILES | [2H]C1(C[C@H]2[C@@H]3CCC4=C([C@H]3CC[C@@]2([C@H]1O)C)C=CC(=C4)O)[2H] |
Computed by PubChem (NCBI)