CAS 81586-94-9 appears in our catalog under these names: 17Alpha-Estradiol-2,4-d2, >95% (HPLC), 17alpha-Estradiol D2 (2,4-D2), 17alpha-Estradiol-2,4-d2, 98 atom % D, min 98% Chemical Purity, Alpha–Estradiol–d2, Alpha-Estradiol-d2, 99.75%. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 5 mg, 1 mg, 1x5mg.
(8R,9S,13S,14S,17R)-2,4-dideuterio-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (CAS 81586-94-9) is a chemical compound with the molecular formula C18H24O2 and a molecular weight of 274.4 g/mol. IUPAC name: (8R,9S,13S,14S,17R)-2,4-dideuterio-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol. InChIKey: VOXZDWNPVJITMN-BHOSFUFTSA-N.
| Molecular formula | C18H24O2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | (8R,9S,13S,14S,17R)-2,4-dideuterio-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | VOXZDWNPVJITMN-BHOSFUFTSA-N |
| SMILES | [2H]C1=CC2=C(CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@H]4O)C)C(=C1O)[2H] |
Computed by PubChem (NCBI)