Products 31881-86-4

CAS 31881-86-4 is the registry number for 2-(2-bromo-4-methylphenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(2-bromo-4-methylphenyl)acetic acid (CAS 31881-86-4) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-(2-bromo-4-methylphenyl)acetic acid. InChIKey: VENUNMMLXJLOCO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrO2
Molecular weight229.07 g/mol
IUPAC name2-(2-bromo-4-methylphenyl)acetic acid
InChIKeyVENUNMMLXJLOCO-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)CC(=O)O)Br

Computed by PubChem (NCBI)