CAS 31928-20-8 appears in our catalog under these names: Methyl 2-amino-3,4-dimethylbenzoate, 95%, Methyl 2-amino-3,4-dimethylbenzoate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 10g.
Methyl 2-amino-3,4-dimethylbenzoate (CAS 31928-20-8) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 2-amino-3,4-dimethylbenzoate. InChIKey: SHRUMQVHQPPAGZ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 2-amino-3,4-dimethylbenzoate |
| InChIKey | SHRUMQVHQPPAGZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC)N)C |
Computed by PubChem (NCBI)