CAS 319474-35-6 appears in our catalog under these names: 3-Formyl-1H-indazole-6-carboxylic acid, 3-Formyl-1h-indazole-6-carboxylic acid, 95%, 3-Formyl-1H-indazole-6-carboxylic acid, 97%, 97%, 3-Formyl-1H-indazole-6-carboxylic acid, 97%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 250mg, 100mg, 10g, 1g, 5g.
3-formyl-2H-indazole-6-carboxylic acid (CAS 319474-35-6) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-formyl-2H-indazole-6-carboxylic acid. InChIKey: HSRKNZOHAZLZKQ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-formyl-2H-indazole-6-carboxylic acid |
| InChIKey | HSRKNZOHAZLZKQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C=C1C(=O)O)C=O |
Computed by PubChem (NCBI)