Products 32018-88-5
CAS 32018-88-5 appears in our catalog under these names: 5-Amino-1-naphthoic acid, 98%, 5-Amino-1-naphthoic acid, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-aminonaphthalene-1-carboxylic acid (CAS 32018-88-5) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 5-aminonaphthalene-1-carboxylic acid. InChIKey: FPKNJPIDCMAIDW-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 5-aminonaphthalene-1-carboxylic acid |
| InChIKey | FPKNJPIDCMAIDW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2N)C(=C1)C(=O)O |
Computed by PubChem (NCBI)