Products 32018-89-6

CAS 32018-89-6 is the registry number for 6-Aminonaphthalene-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-aminonaphthalene-1-carboxylic acid (CAS 32018-89-6) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 6-aminonaphthalene-1-carboxylic acid. InChIKey: CKSZZOAKPXZMAT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO2
Molecular weight187.19 g/mol
IUPAC name6-aminonaphthalene-1-carboxylic acid
InChIKeyCKSZZOAKPXZMAT-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2)N)C(=C1)C(=O)O

Computed by PubChem (NCBI)