CAS 320386-54-7 appears in our catalog under these names: 3-Mercaptopicolinic Acid HCl, 3-Mercaptopicolinic Acid Hydrochloride, >95% (HPLC), SKF-34288 hydrochloride/ 98.77% (existing batch purity), 3–Mercaptopicolinic Acid (hydrochloride), SKF–34288 hydrochloride. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 250mg, 500mg, 5g, 1mg, 5mg, 10mg, 25mg.
3-sulfanylpyridine-2-carboxylic acid;hydrochloride (CAS 320386-54-7) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 3-sulfanylpyridine-2-carboxylic acid;hydrochloride. InChIKey: DYGYEUUVNLEHJP-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 191.64 g/mol |
| IUPAC name | 3-sulfanylpyridine-2-carboxylic acid;hydrochloride |
| InChIKey | DYGYEUUVNLEHJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)O)S.Cl |
Computed by PubChem (NCBI)