Products 320424-47-3
CAS 320424-47-3 is the registry number for 1-(4-Hydroxy-1,3-thiazol-2-yl)-3,3-dimethylbutan-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-hydroxy-1,3-thiazol-2-yl)-3,3-dimethylbutan-2-one (CAS 320424-47-3) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 1-(4-hydroxy-1,3-thiazol-2-yl)-3,3-dimethylbutan-2-one. InChIKey: LOVQGTWYUKVXQM-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 1-(4-hydroxy-1,3-thiazol-2-yl)-3,3-dimethylbutan-2-one |
| InChIKey | LOVQGTWYUKVXQM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC1=NC(=CS1)O |
Computed by PubChem (NCBI)