CAS 32065-66-0 appears in our catalog under these names: 2-Quinoxalinecarboxaldehyde 1,4-Dioxide Dimethyl Acetal, 2-Quinoxalinecarboxaldehyde 1,4-Dioxide Dimethyl Acetal, 98%, 98%. Offered by: TRC, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 1g.
3-(dimethoxymethyl)-4-oxidoquinoxalin-1-ium 1-oxide (CAS 32065-66-0) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: 3-(dimethoxymethyl)-4-oxidoquinoxalin-1-ium 1-oxide. InChIKey: BWTLITYWRKJWIM-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 3-(dimethoxymethyl)-4-oxidoquinoxalin-1-ium 1-oxide |
| InChIKey | BWTLITYWRKJWIM-UHFFFAOYSA-N |
| SMILES | COC(C1=C[N+](=O)C2=CC=CC=C2N1[O-])OC |
Computed by PubChem (NCBI)