CAS 321318-42-7 appears in our catalog under these names: (R)-1-(4-Fluorophenyl)ethanamine hydrochloride 95%, (R)-1-(4-Fluorophenyl)ethanamine hydrochloride, 98%, 98%, (R)-1-(4-Fluorophenyl)ethylamine hydrochloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 250mg, 1g.
(1R)-1-(4-fluorophenyl)ethanamine;hydrochloride (CAS 321318-42-7) is a chemical compound with the molecular formula C8H11ClFN and a molecular weight of 175.63 g/mol. IUPAC name: (1R)-1-(4-fluorophenyl)ethanamine;hydrochloride. InChIKey: MBYCTXPTBWSAMJ-FYZOBXCZSA-N.
| Molecular formula | C8H11ClFN |
|---|---|
| Molecular weight | 175.63 g/mol |
| IUPAC name | (1R)-1-(4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | MBYCTXPTBWSAMJ-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)