Products 3215-45-0
CAS 3215-45-0 appears in our catalog under these names: 9-Ethyl-9H-carbazole-3,6-dicarboxylic acid, 95+%, 9-Ethyl-9H-Carbazole-3,6-Dicarboxylic Acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
9-ethylcarbazole-3,6-dicarboxylic acid (CAS 3215-45-0) is a chemical compound with the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. IUPAC name: 9-ethylcarbazole-3,6-dicarboxylic acid. InChIKey: MYFXCPANJUZOOT-UHFFFAOYSA-N.
| Molecular formula | C16H13NO4 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 9-ethylcarbazole-3,6-dicarboxylic acid |
| InChIKey | MYFXCPANJUZOOT-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C(=O)O)C3=C1C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)