Products 321531-57-1
CAS 321531-57-1 is the registry number for 4-Chloro-3-nitro-n-n-propylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-3-nitro-N-propylbenzamide (CAS 321531-57-1) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: 4-chloro-3-nitro-N-propylbenzamide. InChIKey: ZGGRHAZHLVGWPF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | 4-chloro-3-nitro-N-propylbenzamide |
| InChIKey | ZGGRHAZHLVGWPF-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)