Products 321532-92-7
CAS 321532-92-7 is the registry number for N-(2-Chloro-5-nitrophenyl)cyclopropanecarboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-(2-chloro-5-nitrophenyl)cyclopropanecarboxamide (CAS 321532-92-7) is a chemical compound with the molecular formula C10H9ClN2O3 and a molecular weight of 240.64 g/mol. IUPAC name: N-(2-chloro-5-nitrophenyl)cyclopropanecarboxamide. InChIKey: WHWYSOGAZYHDGZ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O3 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | N-(2-chloro-5-nitrophenyl)cyclopropanecarboxamide |
| InChIKey | WHWYSOGAZYHDGZ-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)