CAS 321980-75-0 is the registry number for (4-(2,4-dimethylphenyl)(2,5-thiazolyl))phenylamine. Offered by: Biosynth. Available pack sizes: 500mg.
4-(2,4-dimethylphenyl)-N-phenyl-1,3-thiazol-2-amine (CAS 321980-75-0) is a chemical compound with the molecular formula C17H16N2S and a molecular weight of 280.4 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-N-phenyl-1,3-thiazol-2-amine. InChIKey: QJUHVNXEKLQHMT-UHFFFAOYSA-N.
| Molecular formula | C17H16N2S |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-N-phenyl-1,3-thiazol-2-amine |
| InChIKey | QJUHVNXEKLQHMT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CSC(=N2)NC3=CC=CC=C3)C |
Computed by PubChem (NCBI)