CAS 793678-93-0 is the registry number for 1-(2,4-Dimethylphenyl)-5-phenyl-1H-imidazole-2-thiol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2,4-dimethylphenyl)-4-phenyl-1H-imidazole-2-thione (CAS 793678-93-0) is a chemical compound with the molecular formula C17H16N2S and a molecular weight of 280.4 g/mol. IUPAC name: 3-(2,4-dimethylphenyl)-4-phenyl-1H-imidazole-2-thione. InChIKey: ITHHYOONFRHLIQ-UHFFFAOYSA-N.
| Molecular formula | C17H16N2S |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 3-(2,4-dimethylphenyl)-4-phenyl-1H-imidazole-2-thione |
| InChIKey | ITHHYOONFRHLIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=CNC2=S)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)