CAS 325994-32-9 is the registry number for 1-(2,4-Dimethylphenyl)-4-phenyl-1H-imidazole-2-thiol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2,4-dimethylphenyl)-5-phenyl-1H-imidazole-2-thione (CAS 325994-32-9) is a chemical compound with the molecular formula C17H16N2S and a molecular weight of 280.4 g/mol. IUPAC name: 3-(2,4-dimethylphenyl)-5-phenyl-1H-imidazole-2-thione. InChIKey: OQXFXHNKQLIDIG-UHFFFAOYSA-N.
| Molecular formula | C17H16N2S |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 3-(2,4-dimethylphenyl)-5-phenyl-1H-imidazole-2-thione |
| InChIKey | OQXFXHNKQLIDIG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C=C(NC2=S)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)