CAS 380472-75-3 appears in our catalog under these names: N-(2,6-Dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine, 95%, N-(2,6-Dimethylphenyl)-4-phenylthiazol-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-(2,6-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine (CAS 380472-75-3) is a chemical compound with the molecular formula C17H16N2S and a molecular weight of 280.4 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine. InChIKey: OFJFQYHGTLTVEH-UHFFFAOYSA-N.
| Molecular formula | C17H16N2S |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine |
| InChIKey | OFJFQYHGTLTVEH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=NC(=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)