CAS 32286-99-0 appears in our catalog under these names: 1–Methyl–4,5,6,7–tetrahydro–1H–indazole–3–carboxylic acid, 1-Methyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid, 1-Methyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid, 97%, 97%, 1-methyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid, 98%, 1-Methyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 5g, 0,5g, 25mg, 500mg, 1g, 10g.
1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid (CAS 32286-99-0) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid. InChIKey: GRVDRWFCDKSVJP-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 1-methyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| InChIKey | GRVDRWFCDKSVJP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(CCCC2)C(=N1)C(=O)O |
Computed by PubChem (NCBI)