CAS 32380-69-1 appears in our catalog under these names: 2-(2-Hydroxyethoxy)-2,3-dihydro-1h-isoindole-1,3-dione, 95%, 2-(2-Hydroxyethoxy)isoindoline-1,3-dione, 98%, 98%, 2-(2-Hydroxyethoxy)isoindoline-1,3-dione, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-(2-hydroxyethoxy)isoindole-1,3-dione (CAS 32380-69-1) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 2-(2-hydroxyethoxy)isoindole-1,3-dione. InChIKey: DOSUQMBAMQLTFF-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 2-(2-hydroxyethoxy)isoindole-1,3-dione |
| InChIKey | DOSUQMBAMQLTFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OCCO |
Computed by PubChem (NCBI)