CAS 324028-89-9 appears in our catalog under these names: 5,6–Dimethoxypicolinic acid, 5,6-Dimethoxypicolinic acid 97%, 5,6-Dimethoxy-2-pyridinecarboxylic acid, 98%, 98%, 5,6-Dimethoxypicolinic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5,6-dimethoxypyridine-2-carboxylic acid (CAS 324028-89-9) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 5,6-dimethoxypyridine-2-carboxylic acid. InChIKey: KUYQYZCJTXNORX-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 5,6-dimethoxypyridine-2-carboxylic acid |
| InChIKey | KUYQYZCJTXNORX-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C=C1)C(=O)O)OC |
Computed by PubChem (NCBI)