Products 324761-25-3
CAS 324761-25-3 is the registry number for 2,3-Dimethyl-5-oxotetrahydrofuran-3-yl methacrylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2,3-dimethyl-5-oxooxolan-3-yl) 2-methylprop-2-enoate (CAS 324761-25-3) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: (2,3-dimethyl-5-oxooxolan-3-yl) 2-methylprop-2-enoate. InChIKey: VRVJALFOECGRKH-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (2,3-dimethyl-5-oxooxolan-3-yl) 2-methylprop-2-enoate |
| InChIKey | VRVJALFOECGRKH-UHFFFAOYSA-N |
| SMILES | CC1C(CC(=O)O1)(C)OC(=O)C(=C)C |
Computed by PubChem (NCBI)
Synonyms:
2,3-Dimethyl-5-oxotetrahydrofuran-3-yl methacrylate, B,y-dimethy-B-methacryloyloxy-y-butyrola ctone, beta,gamma-dimethyl-beta-methacryloyloxy-gamma-butyrolactone, 2- (2-methyl-2-acrylic acid) 2,5-dideoxy-3-methyl-gamma lactone valeric acid, Pentonic acid, 2,5-dideoxy-3-C-methyl-, gamma-lactone, 3-(2-methyl-2-propenoate)