CAS 3254-93-1 appears in our catalog under these names: Phenytoin Sodium impurity 4, Phenytoin Impurity 3, Doxenitoin. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1000mg.
5,5-diphenylimidazolidin-4-one (CAS 3254-93-1) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: 5,5-diphenylimidazolidin-4-one. InChIKey: FEJIIZAOQRTGPC-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 5,5-diphenylimidazolidin-4-one |
| InChIKey | FEJIIZAOQRTGPC-UHFFFAOYSA-N |
| SMILES | C1NC(=O)C(N1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)