Products 325457-99-6
CAS 325457-99-6 appears in our catalog under these names: ICA 110381, 99%, ICA 110381, ICA 110381/ 98%, ICA-110381, ICA 110381, 99.85%. Offered by: Ambeed, Chemat, GLPBio, TargetMol, Biosynth. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 50mg, 100mg, 25mg, 50 mg.
4-chloro-N-(6-chloro-3-pyridinyl)benzamide (CAS 325457-99-6) is a chemical compound with the molecular formula C12H8Cl2N2O and a molecular weight of 267.11 g/mol. IUPAC name: 4-chloro-N-(6-chloro-3-pyridinyl)benzamide. InChIKey: FOYOGIUAMYSVIT-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O |
|---|---|
| Molecular weight | 267.11 g/mol |
| IUPAC name | 4-chloro-N-(6-chloro-3-pyridinyl)benzamide |
| InChIKey | FOYOGIUAMYSVIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CN=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)