CAS 68279-87-8 is the registry number for N-(2,6-Dichlorophenyl)pyridine-4-carboxamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(2,6-dichlorophenyl)pyridine-4-carboxamide (CAS 68279-87-8) is a chemical compound with the molecular formula C12H8Cl2N2O and a molecular weight of 267.11 g/mol. IUPAC name: N-(2,6-dichlorophenyl)pyridine-4-carboxamide. InChIKey: QAVSNPROYYFVPE-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O |
|---|---|
| Molecular weight | 267.11 g/mol |
| IUPAC name | N-(2,6-dichlorophenyl)pyridine-4-carboxamide |
| InChIKey | QAVSNPROYYFVPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NC(=O)C2=CC=NC=C2)Cl |
Computed by PubChem (NCBI)