Products 794544-99-3
CAS 794544-99-3 is the registry number for TAS-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2,4-dichlorophenyl)pyridine-2-carboxamide (CAS 794544-99-3) is a chemical compound with the molecular formula C12H8Cl2N2O and a molecular weight of 267.11 g/mol. IUPAC name: N-(2,4-dichlorophenyl)pyridine-2-carboxamide. InChIKey: ZNMWFDKCPWCBBU-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O |
|---|---|
| Molecular weight | 267.11 g/mol |
| IUPAC name | N-(2,4-dichlorophenyl)pyridine-2-carboxamide |
| InChIKey | ZNMWFDKCPWCBBU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)NC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)